DẪN 1.68 LÍT HỖN HỢP KHÍ X GỒM HAI

     

Dẫn 1,68 lít các thành phần hỗn hợp khí X tất cả hai hiđrocacbon vào bình đựng dung dịch brom (dư). Sau khi phản ứng xẩy ra hoàn toàn, gồm 4 gam brom đã phản ứng và còn lại 1,12 lít khí. Ví như đốt cháy trọn vẹn 1,68 lít X thì sinh ra 2,8 lít khí CO2. Biết các thể tích khí hầu hết đo sinh sống đktc. Công thức phân tử của nhì hiđrocacbon là:




Bạn đang xem: Dẫn 1.68 lít hỗn hợp khí x gồm hai

+) sau khi phản ứng với Br2, khí thoát ra là ankan

+) bao gồm số mol ankan => số mol khí của hiđrocabon còn lại

+) trường đoản cú số mol Brom và số mol của hiđrocabon tính số links pi => công thức chung

+) $overline C = dfracV_CO_2V_X$

=> Công thức 


Ta tất cả nX = 0,075 mol

Cho X qua brom khí không trở nên hấp thụ là ankan => nankan = 0,05 mol

=> nhiđrocacbon sót lại = 0,075 - 0,025 = 0,025 mol

Mà $n_Br_2 = dfrac4160 = 0,025,mol$

=> số pi vào hiđrocacbon là 1

=> cách làm là CnH2n

Sau khi phản ứng với Br2, khí thoát ra là ankan

$overline C = dfracV_CO_2V_X = dfrac2,81,68 approx 1,67$ => Ankan là CH4

Tỉ lệ thể tích bằng tỉ lệ số mol

0,05 → 0,05

0,025 → 0,075

=> n =3

=> cách làm là C3H6


Nhóm 2K5 ôn thi review năng lực 2023 miễn phí

*

Theo dõi Vừng ơi trên

*
*


*
*
*
*
*
*
*
*

Cho những chất sau: 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4). Gần như chất nào là đồng phân của nhau ?


Cho những chất sau: CH2=CHCH2CH2CH=CH2; CH2=CHCH=CHCH2CH3; CH3C(CH3)=CHCH2; CH2=CHCH2CH=CH2; CH3CH2CH=CHCH2CH3; CH3C(CH3)=CHCH2CH3; CH3CH2C(CH3)=C(C2H5)CH(CH3)2; CH3CH=CHCH3.

Số chất tất cả đồng phân hình học là:


Anken C4H8 gồm bao nhiêu đồng phân khi tính năng với hỗn hợp HCl chỉ cho một sản phẩm hữu cơ duy nhất ?


Ba hiđrocacbon X, Y, Z tiếp nối nhau trong hàng đồng đẳng, trong đó cân nặng phân tử Z gấp đôi trọng lượng phân tử X. Đốt cháy 0,1 mol hóa học Y, thành phầm khí hấp thụ trọn vẹn vào dung dịch Ca(OH)2 dư, chiếm được số gam kết tủa là:


Cho hiđrocacbon X bội nghịch ứng với brom (trong dung dịch) theo tỉ lệ mol 1 : 1, thu được chất hữu cơ Y (chứa 74,08% Br về khối lượng). Khi X phản ứng cùng với HBr thì thu được hai sản phẩm hữu cơ không giống nhau. Tên thường gọi của X là:


Để khử hoàn toàn 200 ml hỗn hợp KMnO4 0,2M tạo thành thành hóa học rắn gray clolor đen cần V lít khí C2H4 (ở đktc). Giá chỉ trị tối thiểu của V là:


Hỗn phù hợp khí X bao gồm H2 và C2H4 bao gồm tỉ khối đối với He là 3,75. Dẫn X qua Ni nung nóng, thu được các thành phần hỗn hợp khí Y gồm tỉ khối đối với He là 5. Công suất của phản ứng hiđro hoá là:


Cho buta-1,3-đien phản bội ứng cùng với Br2 theo tỉ lệ mol 1:1. Số dẫn xuất đibrom (đồng phân cấu trúc và đồng phân hình học) thu được là:




Xem thêm: Có Lẽ Ai Cũng Có Hình Ảnh Người Thầy Trong Trái Tim Em Hã, Miêu Tả Người Thầy Trong Trái Tim Em

Cho 3,12 gam ankin X phản bội ứng cùng với 0,1 mol H2 (xúc tác Pd/PbCO3, to), thu được tất cả hổn hợp Y chỉ cất hai hiđrocacbon. Bí quyết phân tử của X là:


Cho 3,36 lít khí hiđrocacbon X (đktc) bội nghịch ứng trọn vẹn với lượng dư hỗn hợp AgNO3 vào NH3, nhận được 36 gam kết tủa. Công thức phân tử của X là:


Đốt cháy hoàn toàn 6,72 lít (đktc) hỗn hợp có hai hiđrocacbon X và Y (MY > MX), nhận được 11,2 lít khí CO2 (đktc) cùng 10,8 gam H2O. Phương pháp của X là:


Đốt cháy hoàn toàn hỗn hợp M có một ankan X và một ankin Y, thu được số mol CO2 ngay số mol H2O. Thành phần xác suất về số mol của X với Y trong tất cả hổn hợp M theo lần lượt là:


Đốt cháy trọn vẹn 0,2 mol hỗn hợp X tất cả một ankan cùng một anken, nhận được 0,35 mol CO2 và 0,4 mol H2O. Tỷ lệ số mol của anken vào X là:


Đốt cháy hoàn toàn 1 lít hỗn hợp khí gồm C2H2 với hiđrocacbon X sinh ra 2 lít khí CO2 với 2 lít hơi H2O (các thể tích khí cùng hơi đo sinh hoạt cùng điều kiện nhiệt độ, áp suất). Bí quyết phân tử của X là:


Dẫn 1,68 lít tất cả hổn hợp khí X tất cả hai hiđrocacbon vào trong bình đựng dung dịch brom (dư). Sau khi phản ứng xẩy ra hoàn toàn, tất cả 4 gam brom đã phản ứng và còn sót lại 1,12 lít khí. Ví như đốt cháy hoàn toàn 1,68 lít X thì xuất hiện 2,8 lít khí CO2. Biết các thể tích khí phần nhiều đo nghỉ ngơi đktc. Công thức phân tử của nhị hiđrocacbon là:


Hỗn đúng theo X có tỉ khối đối với H2 là 21,2 gồm propan, propen cùng propin. Lúc đốt cháy hoàn toàn 0,1 mol X, tổng cân nặng của CO2 và H2O thu được là:


Cho các thành phần hỗn hợp X tất cả CH4, C2H4 cùng C2H2. Lấy 8,6 gam X chức năng hết với hỗn hợp brom (dư) thì trọng lượng brom làm phản ứng là 48 gam. Phương diện khác, nếu cho 13,44 lít (ở đktc) các thành phần hỗn hợp khí X tác dụng với lượng dư dung dịch AgNO3 vào NH3, chiếm được 36 gam kết tủa. Xác suất thể tích của CH4 bao gồm trong X là:


Hỗn vừa lòng khí X có 0,3 mol H2 với 0,1 mol vinylaxetilen. Nung X một thời gian với xúc tác Ni thu được các thành phần hỗn hợp khí Y có tỉ khối so với không khí là 1. Giả dụ cho cục bộ Y sục thanh nhàn vào dung dịch brom (dư) thì gồm m gam brom gia nhập phản ứng. Quý giá của m là:


Dẫn V lít (ở đktc) các thành phần hỗn hợp X có axetilen cùng hiđro đi qua ống sứ nung nóng, nhận được khí Y. Dẫn Y vào lượng dư AgNO3 (hoặc Ag2O) trong hỗn hợp NH3 thu được 12 gam kết tủa. Khí đi thoát ra khỏi dung dịch phản bội ứng đầy đủ với 16 gam brom và còn sót lại khí Z. Đốt cháy trọn vẹn khí Z chiếm được 2,24 lít khí CO2 (ở đktc) cùng 4,5 gam nước. Quý giá của V bằng:


Đun nóng hỗn hợp X bao gồm 0,06 mol C2H2 với 0,04 mol H2 với xúc tác Ni, sau một thời hạn thu được các thành phần hỗn hợp khí Y. Dẫn tổng thể hỗn vừa lòng Y lội rảnh qua bình đựng hỗn hợp brom (dư) thì còn sót lại 0,448 lít các thành phần hỗn hợp khí Z (ở đktc) bao gồm tỉ khối đối với O2 là 0,5. Khối lượng bình dung dịch brom tăng là:




Xem thêm: Giấc Mơ Con Đè Nát Cuộc Đời Con, Top 20 Là Gì Hay Nhất 2022

Đốt cháy hoàn toàn 0,16 mol các thành phần hỗn hợp X gồm CH4, C2H2, C2H4 với C3H6, thu được 6,272 lít CO2(đktc) và 6,12 gam H2O. Còn mặt khác 10,1 gam X bội nghịch ứng về tối đa với a mol Br2 vào dung dịch. Giá trị của a là


đến dãy các chất: CH4, C2H2, C2H4, C2H5OH, CH2=CH–COOH, C6H5NH2 (anilin), C6H5OH (phenol), C6H6 (benzen). Số hóa học trong dãy phản ứng được cùng với nước brom là: